filmov
tv
If `xcostheta=ycos(theta+(2pi)/3)=z cos(theta+(4pi)/3)` , prove that `x y+y z+z x=0.`
![preview_player](https://i.ytimg.com/vi/gRR6NKFrW5U/maxresdefault.jpg)
Показать описание
, prove that `x y+y z+z x=0.`
If `xcostheta=ycos(theta+(2pi)/3)=z cos(theta+(4pi)/3)` , prove that `x y+y z+z x=0.`
If x cos θ = y cos (θ + 2π/3 ) = z cos ( θ + 4π/3), then find the value of xy + yz + zx #iitjee...
If `x*costheta=y*cos(theta+(2pi)/3)=2.cos(theta+(4pi)/3)` ,then evaluate `xy+yz+zx`.
If `x\ costheta=y cos(theta+(2pi)/3)=z cos(theta+(4pi)/3)` , then write the value of `1/x+1/y+
If `x=ycos((2pi)/3)=zcos((4pi)/3)`, then xy+yz+zx=
If x=ycos((2pi)/(3))=zcos((4pi)/(3)),then what is xy + yz + zx equal to ? | 12 | TRIGONOMETRY - ...
If x.Cosθ=y.Cos(θ+2π/3)=z.Cos(θ+4π/3) Find value of 1/x+1/y+1/z
IIT JEE TRIGONOMETRIC FUNCTIONS If `x/(costheta)=y/(cos(theta-(2pi)/3))=z/(cos(theta+(2pi)/3))` ...
11th Std Maths Ex 3.4(16) If xcosA = ycos(A+2π/3)=zcos(A+4π/3) Find xy+yz+zx
If \( x \cos \theta=y \cos \left(\theta+\frac{2 \pi}{3}\right)=z \cos \left(\theta+\frac{4 \pi}{...
If `x sintheta=ysin(theta+(2pi)/(3))=z sin(theta+(4pi)/(3)),` then
If x sin θ=y(θ+2π/3)=z sin(θ+4π/3) then xy+yz+zx is equal to
If `asintheta=\'bsin\'(theta+(2pi)/3)=\'csin\'(theta+(2pi)/3)` , prove that `a b...
🤣Modi ji ne to math ki esi taisi kar diye🤣🙆🏻♂️ #shorts #youtubeshorts #viral
Prove that all values of theta: `|(sintheta, costheta, sin2theta),(sin(theta+(2pi)/3)
If `a=b cos((2pi)/3)= c cos((4pi)/3),` then write the value o `a b+b c+c a`
`(cosalpha +(cos((2pi)/3+alpha))+cos((4pi)/3+alpha))`
If `asinx`=`bsin(x+(2pi)/3)=csin(x+(4pi)/3)`, prove that ab+bc+ca=0
If `tan((2pi)/3-x)= sin(2pi/3-sin2x)/(cos(2pi/3-cos2x)` where `0 lt x lt pi` then two possibl
If a= b cos (2pi)/(3) = c cos (4pi)/(3), then the value of (ab+ bc +ca) is- | 12 | MCQ's | MATH...
Prove that: `2sin^2(3pi/4)+2cos^2(pi/4)+2sec^2(pi/3)=10`
prove that -sin³x + sin³((2π/3) +x)+ sin³((4π/3) +x)=-(3/4)sin3x| Trigonometry|class-11| chapter-3...
If cos(x-y)/cos (x+y)+cos(z+t)/cos(z-t)=0 then tanx.tany.tanz.tant is|JEE|Main|CET|2024|25|CBSE|MCQ
Prove that `4sinthetasin(pi/3+theta)sin((2pi)/3+theta)=sin3theta`
Комментарии