Prove that: Cos A - Sin A + 1/ Cos A + Sin A - 1 = Cosec A + Cot A

preview_player
Показать описание
Prove that: Cos A - Sin A + 1/ Cos A + Sin A - 1 = Cosec A + Cot A
  1. Math Army
  2. Prove that: Cos A - Sin A 1/ Cos A Sin A - 1 = Cosec A Cot A
  3. trigonometry
  4. introduction to trigonometry
  5. trigonometry class 10
  6. Cos A - Sin A 1/ Cos A Sin A - 1 = Cosec A Cot A
Рекомендации по теме
Trigonometry: Compound angles: 0:09:31

Trigonometry: Compound angles: cos(A-B)=cosAcosB+sinAsinB

Prove that: cos 0:04:13

Prove that: cos A / (1+sin A) + ( 1+sinA) / cosA = 2sec A Class 10 Ex 8.3 Q4 (ii) | Trigonometry

Proof of cos(A+B) 0:13:49

Proof of cos(A+B) formula

Proof of cos(A+B)=cosAcosB-sinAsinB 0:02:57

Proof of cos(A+B)=cosAcosB-sinAsinB using cos(A-B)

Prove that: Cos 0:06:38

Prove that: Cos A - Sin A + 1/ Cos A + Sin A - 1 = Cosec A + Cot A

prove that cos 0:05:15

prove that cos A / (1 - tan A) + sin A /(1 - cot A) = sin A + cos A

Prove (cos A 0:05:28

Prove (cos A - sin A + 1)/(cos A + sin A - 1)= cosec A + cot A | Q5 part (v)

Prove Cos2A=Cos^2A-Sin^2A 0:03:13

Prove Cos2A=Cos^2A-Sin^2A

Coleção Gogos do 0:01:21

Coleção Gogos do Harry Potter da Cacau Show 🧙 🍫 Primeiro Gogo

Using vectors, Prove 0:05:23

Using vectors, Prove that cos(A -B) = cosAcosB + sinAsinB

Proved by vector 0:11:25

Proved by vector method cos(A-B) = (cosA.cosB +sinA.sinB) || cos(a-b)=cosa.cosb+sina.sinb

Prove That Cos(A+B)=CosA 0:10:07

Prove That Cos(A+B)=CosA CosB-SinA SinB by Vector Method (Mathmatices-1(Civil) Vector algebra

sin square theta 0:02:15

sin square theta + cos square theta = 1 How to prove?

Prove (cos A/1+sin 0:06:15

Prove (cos A/1+sin A)+ (1+sin A/cos A)=2 sec A | Exercise 8.4 Q5 part(ii)

Prove (sin A 0:05:34

Prove (sin A + cosec A)^2 + (cos A + sec A)^2=7+ tan^2A + cot^2A | Q5 (viii)

cos(-theta)=cos theta proof 0:00:53

cos(-theta)=cos theta proof | cos minus theta is equal to cos theta

Visual proof of 0:09:25

Visual proof of sin(A+B) and cos(A+B) in one picture

Prove that trigonometry 0:03:20

Prove that trigonometry sin^2 A= (1-cos2A)/2 & cos^2 A= (1+cos2A)/2 PART-8

Prove that cos(x+y)=cosx.cosy-sinx.siny 0:05:46

Prove that cos(x+y)=cosx.cosy-sinx.siny

Prove cos^4 A-cos^2 0:01:57

Prove cos^4 A-cos^2 A=sin^4 A-sin^2 A

#COS(A+B).COS(A-B)=COS²A-SIN²B (or)COS²B-SIN²A 0:01:55

#COS(A+B).COS(A-B)=COS²A-SIN²B (or)COS²B-SIN²A

Prove that (cos 0:07:49

Prove that (cos A-sin A+1) / (cos A+sin A-1) = cosec A+cot A, using identity cosec^2 A= 1+ cot^2 A

Why is tan 0:01:53

Why is tan equal to sin divided by cos

Prove that cos 0:02:24

Prove that cos 55° + cos 65° + cos 175° = 0 | TRIGONOMETRIC TRANSFORMATIONS | EDUTAINMENT ONLINE

Комментарии
Автор

Sir is it like that when we are specifically given using identy cosec2A =1 + cot2A so only can use the identity in that perticular question any time

minakshibisht
Автор

Thnkew soo much Sir...
It was really helpful 4 me

mr.mrs.bhalwal
Автор

You have explained this question very nicely and greatly thank you sir

AnyaSikha-ck
Автор

Thank you so much sir😊😊😊❤ very easily I understand sir ones again thank you sit😊

vijivijimathi
Автор

thank u sir it was very very helpful we are understanding u very easily

vedarajukpruthvi
Автор

why not convert the 1 in denominator😭😭😭😭

mastcuber
Автор

Sir tomorrow maths test
It is very important question
Thanks sir

karthikreddy.p.
Автор

Nicely done, it was helpful thank you.

Vinnan_Thamizh
Автор

Sir u forgot to put the brackets in the 2nd last step... it should be (cot A + cosec A)[1+cot A - cosec A] /... and not cot A+ cosec A [ 1 + cot A - cosec A] /...

diggubhaidd
Автор

But please tell why are we dividing it by sin

PujaKumari-nebb
Автор

Math army 🙅‍♀❌
BTS army ✅💜😎


Who is bts army raise your ✋ ❤❤🎉

BABU-VARsHNEY
Автор

Thank sir it's help me very for term 1st exam
But sir 1 questions is that
How you thought that the equation be divided by Sin A

masumrehan
Автор

Sir please use few words of hindi. It can make good explanation to students

Scroll_with_sigma_boy